About 2,4-diformylbenzoic acid
2,4-diformylbenzoic acid (PubChem CID 22491758) has the molecular formula C9H6O4
and a molecular weight of 178.14 g/mol. Its IUPAC name is 2,4-diformylbenzoic acid.
Molecular Properties
| Compound Name | 2,4-diformylbenzoic acid |
| PubChem CID | 22491758 |
| Molecular Formula | C9H6O4 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 2,4-diformylbenzoic acid |
| SMILES | O=Cc1ccc(C(=O)O)c(C=O)c1 |
| InChI | InChI=1S/C9H6O4/c10-4-6-1-2-8(9(12)13)7(3-6)5-11/h1-5H,(H,12,13) |
| InChIKey | YPMJMLGKZPEJLM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diformylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diformylbenzoic acid?
The IUPAC name of 2,4-diformylbenzoic acid (CID 22491758) is 2,4-diformylbenzoic acid.
What is the SMILES notation for 2,4-diformylbenzoic acid?
The canonical SMILES for 2,4-diformylbenzoic acid is O=Cc1ccc(C(=O)O)c(C=O)c1.
What is the InChIKey of 2,4-diformylbenzoic acid?
The InChIKey is YPMJMLGKZPEJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O4/c10-4-6-1-2-8(9(12)13)7(3-6)5-11/h1-5H,(H,12,13).
What are the key properties of 2,4-diformylbenzoic acid?
2,4-diformylbenzoic acid has a molecular weight of 178.14 g/mol, XLogP of 1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diformylbenzoic acid is sourced from PubChem (CID 22491758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).