About methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate
methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate (PubChem CID 22492252) has the molecular formula C25H21F3N2O4
and a molecular weight of 470.45 g/mol. Its IUPAC name is methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate.
Molecular Properties
| Compound Name | methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate |
| PubChem CID | 22492252 |
| Molecular Formula | C25H21F3N2O4 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate |
| SMILES | COC(=O)CN(C(=O)CN(C(=O)Cc1cc(F)cc(F)c1)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H21F3N2O4/c1-34-25(33)16-30(21-5-3-2-4-6-21)24(32)15-29(22-9-7-18(26)8-10-22)23(31)13-17-11-19(27)14-20(28)12-17/h2-12,14H,13,15-16H2,1H3 |
| InChIKey | ZDDCXLOABUSDRK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate?
The IUPAC name of methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate (CID 22492252) is methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate.
What is the SMILES notation for methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate?
The canonical SMILES for methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate is COC(=O)CN(C(=O)CN(C(=O)Cc1cc(F)cc(F)c1)c1ccc(F)cc1)c1ccccc1.
What is the InChIKey of methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate?
The InChIKey is ZDDCXLOABUSDRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21F3N2O4/c1-34-25(33)16-30(21-5-3-2-4-6-21)24(32)15-29(22-9-7-18(26)8-10-22)23(31)13-17-11-19(27)14-20(28)12-17/h2-12,14H,13,15-16H2,1H3.
What are the key properties of methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate?
methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate has a molecular weight of 470.45 g/mol, XLogP of 3.89, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(N-[2-(N-[2-(3,5-difluorophenyl)acetyl]-4-fluoroanilino)acetyl]anilino)acetate is sourced from PubChem (CID 22492252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).