C16H12F7O2P — CID 2249238
[2,2,3,3,4,4,4-heptafluorobutoxy(phenyl)phosphoryl]benzene (PubChem CID 2249238) has the molecular formula C16H12F7O2P and a molecular weight of 400.23 g/mol. Its IUPAC name is [2,2,3,3,4,4,4-heptafluorobutoxy(phenyl)phosphoryl]benzene.
| Compound Name | [2,2,3,3,4,4,4-heptafluorobutoxy(phenyl)phosphoryl]benzene |
|---|---|
| PubChem CID | 2249238 |
| Molecular Formula | C16H12F7O2P |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | [2,2,3,3,4,4,4-heptafluorobutoxy(phenyl)phosphoryl]benzene |
| SMILES | O=P(OCC(F)(F)C(F)(F)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H12F7O2P/c17-14(18,15(19,20)16(21,22)23)11-25-26(24,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | XTMMQBINMKHYNZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|