C17H21NO4S — CID 22492448
ethyl 5-(naphthalen-2-ylsulfamoyl)pentanoate (PubChem CID 22492448) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is ethyl 5-(naphthalen-2-ylsulfamoyl)pentanoate.
| Compound Name | ethyl 5-(naphthalen-2-ylsulfamoyl)pentanoate |
|---|---|
| PubChem CID | 22492448 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | ethyl 5-(naphthalen-2-ylsulfamoyl)pentanoate |
| SMILES | CCOC(=O)CCCCS(=O)(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H21NO4S/c1-2-22-17(19)9-5-6-12-23(20,21)18-16-11-10-14-7-3-4-8-15(14)13-16/h3-4,7-8,10-11,13,18H,2,5-6,9,12H2,1H3 |
| InChIKey | NTJLNRZGARPARL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|