C9H16Cl3NO3 — CID 2249254
ethyl 5-[[(1S)-2,2,2-trichloro-1-hydroxyethyl]amino]pentanoate (PubChem CID 2249254) has the molecular formula C9H16Cl3NO3 and a molecular weight of 292.59 g/mol. Its IUPAC name is ethyl 5-[[(1S)-2,2,2-trichloro-1-hydroxyethyl]amino]pentanoate.
| Compound Name | ethyl 5-[[(1S)-2,2,2-trichloro-1-hydroxyethyl]amino]pentanoate |
|---|---|
| PubChem CID | 2249254 |
| Molecular Formula | C9H16Cl3NO3 |
| Molecular Weight | 292.59 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | ethyl 5-[[(1S)-2,2,2-trichloro-1-hydroxyethyl]amino]pentanoate |
| SMILES | CCOC(=O)CCCCN[C@@H](O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H16Cl3NO3/c1-2-16-7(14)5-3-4-6-13-8(15)9(10,11)12/h8,13,15H,2-6H2,1H3/t8-/m0/s1 |
| InChIKey | NDFODQCSMZZEJK-QMMMGPOBSA-N |
| XLogP | 2.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.59 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|