C17H22O4 — CID 22492701
3,5-dimethylbenzene-1,2-diol;3,4,5-trimethylbenzene-1,2-diol (PubChem CID 22492701) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 3,5-dimethylbenzene-1,2-diol;3,4,5-trimethylbenzene-1,2-diol.
| Compound Name | 3,5-dimethylbenzene-1,2-diol;3,4,5-trimethylbenzene-1,2-diol |
|---|---|
| PubChem CID | 22492701 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 3,5-dimethylbenzene-1,2-diol;3,4,5-trimethylbenzene-1,2-diol |
| SMILES | Cc1cc(C)c(O)c(O)c1.Cc1cc(O)c(O)c(C)c1C |
| InChI | InChI=1S/C9H12O2.C8H10O2/c1-5-4-8(10)9(11)7(3)6(5)2;1-5-3-6(2)8(10)7(9)4-5/h4,10-11H,1-3H3;3-4,9-10H,1-2H3 |
| InChIKey | XSSSPYODULXOAQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|