About 4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol
4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol (PubChem CID 22492711) has the molecular formula C24H26O2
and a molecular weight of 346.47 g/mol. Its IUPAC name is 4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol |
| PubChem CID | 22492711 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(Cc2ccc(Cc3cc(C)c(O)c(C)c3)cc2)cc(C)c1O |
| InChI | InChI=1S/C24H26O2/c1-15-9-21(10-16(2)23(15)25)13-19-5-7-20(8-6-19)14-22-11-17(3)24(26)18(4)12-22/h5-12,25-26H,13-14H2,1-4H3 |
| InChIKey | RPWUJNUSSDPLDJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol?
The IUPAC name of 4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol (CID 22492711) is 4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol.
What is the SMILES notation for 4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol?
The canonical SMILES for 4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol is Cc1cc(Cc2ccc(Cc3cc(C)c(O)c(C)c3)cc2)cc(C)c1O.
What is the InChIKey of 4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol?
The InChIKey is RPWUJNUSSDPLDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O2/c1-15-9-21(10-16(2)23(15)25)13-19-5-7-20(8-6-19)14-22-11-17(3)24(26)18(4)12-22/h5-12,25-26H,13-14H2,1-4H3.
What are the key properties of 4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol?
4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol has a molecular weight of 346.47 g/mol, XLogP of 5.51, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]methyl]-2,6-dimethylphenol is sourced from PubChem (CID 22492711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).