C32H35F3N4O4S — CID 22492912
ethyl 4-[2-[4-(1-cyclohexylpiperidin-4-yl)phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoate;2,2,2-trifluoroacetic acid (PubChem CID 22492912) has the molecular formula C32H35F3N4O4S and a molecular weight of 628.72 g/mol. Its IUPAC name is ethyl 4-[2-[4-(1-cyclohexylpiperidin-4-yl)phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 4-[2-[4-(1-cyclohexylpiperidin-4-yl)phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22492912 |
| Molecular Formula | C32H35F3N4O4S |
| Molecular Weight | 628.72 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | ethyl 4-[2-[4-(1-cyclohexylpiperidin-4-yl)phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)c1ccc(-c2cn3nc(-c4ccc(C5CCN(C6CCCCC6)CC5)cc4)sc3n2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H34N4O2S.C2HF3O2/c1-2-36-29(35)25-14-10-23(11-15-25)27-20-34-30(31-27)37-28(32-34)24-12-8-21(9-13-24)22-16-18-33(19-17-22)26-6-4-3-5-7-26;3-2(4,5)1(6)7/h8-15,20,22,26H,2-7,16-19H2,1H3;(H,6,7) |
| InChIKey | PYBONDASNKLURN-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.72 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |