About 8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane
8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane (PubChem CID 22492982) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 22492982 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane |
| SMILES | COC1(c2ccccc2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H20O3/c1-16-14(13-5-3-2-4-6-13)7-9-15(10-8-14)17-11-12-18-15/h2-6H,7-12H2,1H3 |
| InChIKey | MGUGJHZIKBJNIV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane (CID 22492982) is 8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane is COC1(c2ccccc2)CCC2(CC1)OCCO2.
What is the InChIKey of 8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane?
The InChIKey is MGUGJHZIKBJNIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-16-14(13-5-3-2-4-6-13)7-9-15(10-8-14)17-11-12-18-15/h2-6H,7-12H2,1H3.
What are the key properties of 8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane?
8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane has a molecular weight of 248.32 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-8-phenyl-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 22492982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).