About [2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone
[2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone (PubChem CID 22493231) has the molecular formula C16H22N4O
and a molecular weight of 286.38 g/mol. Its IUPAC name is [2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | [2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone |
| PubChem CID | 22493231 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccccc1NCC1=NCCN1)N1CCCCC1 |
| InChI | InChI=1S/C16H22N4O/c21-16(20-10-4-1-5-11-20)13-6-2-3-7-14(13)19-12-15-17-8-9-18-15/h2-3,6-7,19H,1,4-5,8-12H2,(H,17,18) |
| InChIKey | CNOGTSVNRSSSOR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone?
The IUPAC name of [2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone (CID 22493231) is [2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone.
What is the SMILES notation for [2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone?
The canonical SMILES for [2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone is O=C(c1ccccc1NCC1=NCCN1)N1CCCCC1.
What is the InChIKey of [2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone?
The InChIKey is CNOGTSVNRSSSOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O/c21-16(20-10-4-1-5-11-20)13-6-2-3-7-14(13)19-12-15-17-8-9-18-15/h2-3,6-7,19H,1,4-5,8-12H2,(H,17,18).
What are the key properties of [2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone?
[2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone has a molecular weight of 286.38 g/mol, XLogP of 1.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4,5-dihydro-1H-imidazol-2-ylmethylamino)phenyl]-piperidin-1-ylmethanone is sourced from PubChem (CID 22493231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).