About N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline (PubChem CID 22493289) has the molecular formula C14H15N5
and a molecular weight of 253.31 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline |
| PubChem CID | 22493289 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline |
| SMILES | c1cnc(-c2ccccc2NCC2=NCCN2)nc1 |
| InChI | InChI=1S/C14H15N5/c1-2-5-12(19-10-13-15-8-9-16-13)11(4-1)14-17-6-3-7-18-14/h1-7,19H,8-10H2,(H,15,16) |
| InChIKey | CMDSTJSCXRZEFV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline (CID 22493289) is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline is c1cnc(-c2ccccc2NCC2=NCCN2)nc1.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline?
The InChIKey is CMDSTJSCXRZEFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N5/c1-2-5-12(19-10-13-15-8-9-16-13)11(4-1)14-17-6-3-7-18-14/h1-7,19H,8-10H2,(H,15,16).
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline?
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline has a molecular weight of 253.31 g/mol, XLogP of 1.56, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-pyrimidin-2-ylaniline is sourced from PubChem (CID 22493289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).