About butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline
butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline (PubChem CID 22493433) has the molecular formula C14H24N4
and a molecular weight of 248.37 g/mol. Its IUPAC name is butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline.
Molecular Properties
| Compound Name | butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline |
| PubChem CID | 22493433 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline |
| SMILES | CCC(C)N.Nc1ccccc1CC1=NCCN1 |
| InChI | InChI=1S/C10H13N3.C4H11N/c11-9-4-2-1-3-8(9)7-10-12-5-6-13-10;1-3-4(2)5/h1-4H,5-7,11H2,(H,12,13);4H,3,5H2,1-2H3 |
| InChIKey | CXAHZEJQSZCMNR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline?
The IUPAC name of butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline (CID 22493433) is butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline.
What is the SMILES notation for butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline?
The canonical SMILES for butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline is CCC(C)N.Nc1ccccc1CC1=NCCN1.
What is the InChIKey of butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline?
The InChIKey is CXAHZEJQSZCMNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3.C4H11N/c11-9-4-2-1-3-8(9)7-10-12-5-6-13-10;1-3-4(2)5/h1-4H,5-7,11H2,(H,12,13);4H,3,5H2,1-2H3.
What are the key properties of butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline?
butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline has a molecular weight of 248.37 g/mol, XLogP of 1.56, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-amine;2-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline is sourced from PubChem (CID 22493433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).