C24H25NO4 — CID 22493448
8,9-dimethoxy-6-(5-methoxy-1-benzofuran-2-yl)-1,2,3,4,4a,10b-hexahydrophenanthridine (PubChem CID 22493448) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 8,9-dimethoxy-6-(5-methoxy-1-benzofuran-2-yl)-1,2,3,4,4a,10b-hexahydrophenanthridine.
| Compound Name | 8,9-dimethoxy-6-(5-methoxy-1-benzofuran-2-yl)-1,2,3,4,4a,10b-hexahydrophenanthridine |
|---|---|
| PubChem CID | 22493448 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 8,9-dimethoxy-6-(5-methoxy-1-benzofuran-2-yl)-1,2,3,4,4a,10b-hexahydrophenanthridine |
| SMILES | COc1ccc2oc(C3=NC4CCCCC4c4cc(OC)c(OC)cc43)cc2c1 |
| InChI | InChI=1S/C24H25NO4/c1-26-15-8-9-20-14(10-15)11-23(29-20)24-18-13-22(28-3)21(27-2)12-17(18)16-6-4-5-7-19(16)25-24/h8-13,16,19H,4-7H2,1-3H3 |
| InChIKey | GEFKSGJOKDNXEX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 53.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |