C20H24N2O3 — CID 22493451
4-(8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)-3,5-dimethyl-1,2-oxazole (PubChem CID 22493451) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 4-(8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-(8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 22493451 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 4-(8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)-3,5-dimethyl-1,2-oxazole |
| SMILES | COc1cc2c(cc1OC)C1CCCCC1N=C2c1c(C)noc1C |
| InChI | InChI=1S/C20H24N2O3/c1-11-19(12(2)25-22-11)20-15-10-18(24-4)17(23-3)9-14(15)13-7-5-6-8-16(13)21-20/h9-10,13,16H,5-8H2,1-4H3 |
| InChIKey | OHFRJTUNRCZBJZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 56.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |