C16H25NO4 — CID 22493983
ethyl 3-[3-(aminomethyl)-4-methoxyphenyl]-2-propan-2-yloxypropanoate (PubChem CID 22493983) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is ethyl 3-[3-(aminomethyl)-4-methoxyphenyl]-2-propan-2-yloxypropanoate.
| Compound Name | ethyl 3-[3-(aminomethyl)-4-methoxyphenyl]-2-propan-2-yloxypropanoate |
|---|---|
| PubChem CID | 22493983 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | ethyl 3-[3-(aminomethyl)-4-methoxyphenyl]-2-propan-2-yloxypropanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OC)c(CN)c1)OC(C)C |
| InChI | InChI=1S/C16H25NO4/c1-5-20-16(18)15(21-11(2)3)9-12-6-7-14(19-4)13(8-12)10-17/h6-8,11,15H,5,9-10,17H2,1-4H3 |
| InChIKey | IPGWVGWWRJXEKY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |