C27H30N4O4S — CID 22494691
4-[2-[2-[4-(4-methoxybutoxy)piperidin-1-yl]phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoic acid (PubChem CID 22494691) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is 4-[2-[2-[4-(4-methoxybutoxy)piperidin-1-yl]phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoic acid.
| Compound Name | 4-[2-[2-[4-(4-methoxybutoxy)piperidin-1-yl]phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoic acid |
|---|---|
| PubChem CID | 22494691 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 4-[2-[2-[4-(4-methoxybutoxy)piperidin-1-yl]phenyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]benzoic acid |
| SMILES | COCCCCOC1CCN(c2ccccc2-c2nn3cc(-c4ccc(C(=O)O)cc4)nc3s2)CC1 |
| InChI | InChI=1S/C27H30N4O4S/c1-34-16-4-5-17-35-21-12-14-30(15-13-21)24-7-3-2-6-22(24)25-29-31-18-23(28-27(31)36-25)19-8-10-20(11-9-19)26(32)33/h2-3,6-11,18,21H,4-5,12-17H2,1H3,(H,32,33) |
| InChIKey | RESNRAQNVLMFQZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|