About hexanedioate;hydron
hexanedioate;hydron (PubChem CID 22494954) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is hexanedioate;hydron.
Molecular Properties
| Compound Name | hexanedioate;hydron |
| PubChem CID | 22494954 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | hexanedioate;hydron |
| SMILES | O=C([O-])CCCCC(=O)[O-].[H+].[H+] |
| InChI | InChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10) |
| InChIKey | WNLRTRBMVRJNCN-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanedioate;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanedioate;hydron?
The IUPAC name of hexanedioate;hydron (CID 22494954) is hexanedioate;hydron.
What is the SMILES notation for hexanedioate;hydron?
The canonical SMILES for hexanedioate;hydron is O=C([O-])CCCCC(=O)[O-].[H+].[H+].
What is the InChIKey of hexanedioate;hydron?
The InChIKey is WNLRTRBMVRJNCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10).
What are the key properties of hexanedioate;hydron?
hexanedioate;hydron has a molecular weight of 146.14 g/mol, XLogP of -1.73, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexanedioate;hydron is sourced from PubChem (CID 22494954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).