C24H22ClN3O — CID 2249500
2-chloro-N-[[4-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)phenyl]methylideneamino]benzamide (PubChem CID 2249500) has the molecular formula C24H22ClN3O and a molecular weight of 403.91 g/mol. Its IUPAC name is 2-chloro-N-[[4-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)phenyl]methylideneamino]benzamide.
| Compound Name | 2-chloro-N-[[4-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 2249500 |
| Molecular Formula | C24H22ClN3O |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-chloro-N-[[4-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)phenyl]methylideneamino]benzamide |
| SMILES | Cc1cc2c(cc1C)CN(c1ccc(C=NNC(=O)c3ccccc3Cl)cc1)C2 |
| InChI | InChI=1S/C24H22ClN3O/c1-16-11-19-14-28(15-20(19)12-17(16)2)21-9-7-18(8-10-21)13-26-27-24(29)22-5-3-4-6-23(22)25/h3-13H,14-15H2,1-2H3,(H,27,29) |
| InChIKey | UDOKOBBCYXYAIO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|