C16H5F6NO3 — CID 2249523
1-(3,4-difluorophenyl)-5,6,7,8-tetrafluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 2249523) has the molecular formula C16H5F6NO3 and a molecular weight of 373.21 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-5,6,7,8-tetrafluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-(3,4-difluorophenyl)-5,6,7,8-tetrafluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 2249523 |
| Molecular Formula | C16H5F6NO3 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 1-(3,4-difluorophenyl)-5,6,7,8-tetrafluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(-c2ccc(F)c(F)c2)c2c(F)c(F)c(F)c(F)c2c1=O |
| InChI | InChI=1S/C16H5F6NO3/c17-7-2-1-5(3-8(7)18)23-4-6(16(25)26)15(24)9-10(19)11(20)12(21)13(22)14(9)23/h1-4H,(H,25,26) |
| InChIKey | OQSLECJDJPGLAX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|