About bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide
bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide (PubChem CID 22495458) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide.
Molecular Properties
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide |
| PubChem CID | 22495458 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide |
| SMILES | C=CCCC(=O)NO.c1ccc2c(c1)C2 |
| InChI | InChI=1S/C7H6.C5H9NO2/c1-2-4-7-5-6(7)3-1;1-2-3-4-5(7)6-8/h1-4H,5H2;2,8H,1,3-4H2,(H,6,7) |
| InChIKey | OBLDNZXHAPPMIR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide?
The IUPAC name of bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide (CID 22495458) is bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide.
What is the SMILES notation for bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide?
The canonical SMILES for bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide is C=CCCC(=O)NO.c1ccc2c(c1)C2.
What is the InChIKey of bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide?
The InChIKey is OBLDNZXHAPPMIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6.C5H9NO2/c1-2-4-7-5-6(7)3-1;1-2-3-4-5(7)6-8/h1-4H,5H2;2,8H,1,3-4H2,(H,6,7).
What are the key properties of bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide?
bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide has a molecular weight of 205.26 g/mol, XLogP of 2.05, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.1.0]hepta-1,3,5-triene;N-hydroxypent-4-enamide is sourced from PubChem (CID 22495458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).