C10H24Br3N3 — CID 22495462
1,2,3,4,5,6,7,9,10,11,12,12a-dodecahydropyrido[1,2-a][1,4,7]triazonine;trihydrobromide (PubChem CID 22495462) has the molecular formula C10H24Br3N3 and a molecular weight of 426.04 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,9,10,11,12,12a-dodecahydropyrido[1,2-a][1,4,7]triazonine;trihydrobromide.
| Compound Name | 1,2,3,4,5,6,7,9,10,11,12,12a-dodecahydropyrido[1,2-a][1,4,7]triazonine;trihydrobromide |
|---|---|
| PubChem CID | 22495462 |
| Molecular Formula | C10H24Br3N3 |
| Molecular Weight | 426.04 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | 1,2,3,4,5,6,7,9,10,11,12,12a-dodecahydropyrido[1,2-a][1,4,7]triazonine;trihydrobromide |
| SMILES | Br.Br.Br.C1CCN2CCNCCNCC2C1 |
| InChI | InChI=1S/C10H21N3.3BrH/c1-2-7-13-8-6-11-4-5-12-9-10(13)3-1;;;/h10-12H,1-9H2;3*1H |
| InChIKey | HLRORSZQOLTGDZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.04 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |