About 4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride
4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride (PubChem CID 22495691) has the molecular formula C15H18ClF2NO
and a molecular weight of 301.76 g/mol. Its IUPAC name is 4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | 4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride |
| PubChem CID | 22495691 |
| Molecular Formula | C15H18ClF2NO |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride |
| SMILES | CC1(C)CNCCC1c1c(F)cc(F)c2ccoc12.Cl |
| InChI | InChI=1S/C15H17F2NO.ClH/c1-15(2)8-18-5-3-10(15)13-12(17)7-11(16)9-4-6-19-14(9)13;/h4,6-7,10,18H,3,5,8H2,1-2H3;1H |
| InChIKey | ZDSMSNLIXROSID-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride?
The IUPAC name of 4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride (CID 22495691) is 4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride.
What is the SMILES notation for 4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride?
The canonical SMILES for 4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride is CC1(C)CNCCC1c1c(F)cc(F)c2ccoc12.Cl.
What is the InChIKey of 4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride?
The InChIKey is ZDSMSNLIXROSID-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2NO.ClH/c1-15(2)8-18-5-3-10(15)13-12(17)7-11(16)9-4-6-19-14(9)13;/h4,6-7,10,18H,3,5,8H2,1-2H3;1H.
What are the key properties of 4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride?
4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride has a molecular weight of 301.76 g/mol, XLogP of 4.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,6-difluoro-1-benzofuran-7-yl)-3,3-dimethylpiperidine;hydrochloride is sourced from PubChem (CID 22495691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).