About 5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole
5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole (PubChem CID 22495782) has the molecular formula C14H16BrN3O
and a molecular weight of 322.21 g/mol. Its IUPAC name is 5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole |
| PubChem CID | 22495782 |
| Molecular Formula | C14H16BrN3O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole |
| SMILES | Brc1ccc2oc(N3CCN4CCC3CC4)nc2c1 |
| InChI | InChI=1S/C14H16BrN3O/c15-10-1-2-13-12(9-10)16-14(19-13)18-8-7-17-5-3-11(18)4-6-17/h1-2,9,11H,3-8H2 |
| InChIKey | VGGIXTMKNTVMSP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole?
The IUPAC name of 5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole (CID 22495782) is 5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole.
What is the SMILES notation for 5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole?
The canonical SMILES for 5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole is Brc1ccc2oc(N3CCN4CCC3CC4)nc2c1.
What is the InChIKey of 5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole?
The InChIKey is VGGIXTMKNTVMSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrN3O/c15-10-1-2-13-12(9-10)16-14(19-13)18-8-7-17-5-3-11(18)4-6-17/h1-2,9,11H,3-8H2.
What are the key properties of 5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole?
5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole has a molecular weight of 322.21 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3-benzoxazole is sourced from PubChem (CID 22495782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).