C6H3BrF4O3 — CID 22496362
2-bromo-1-(5,5,6,6-tetrafluoro-1,4-dioxin-2-yl)ethanone (PubChem CID 22496362) has the molecular formula C6H3BrF4O3 and a molecular weight of 278.98 g/mol. Its IUPAC name is 2-bromo-1-(5,5,6,6-tetrafluoro-1,4-dioxin-2-yl)ethanone.
| Compound Name | 2-bromo-1-(5,5,6,6-tetrafluoro-1,4-dioxin-2-yl)ethanone |
|---|---|
| PubChem CID | 22496362 |
| Molecular Formula | C6H3BrF4O3 |
| Molecular Weight | 278.98 g/mol |
| Exact Mass | 277.92 |
| IUPAC Name | 2-bromo-1-(5,5,6,6-tetrafluoro-1,4-dioxin-2-yl)ethanone |
| SMILES | O=C(CBr)C1=COC(F)(F)C(F)(F)O1 |
| InChI | InChI=1S/C6H3BrF4O3/c7-1-3(12)4-2-13-5(8,9)6(10,11)14-4/h2H,1H2 |
| InChIKey | FNBHXFBVNUXWFH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.98 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|