About 1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine
1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine (PubChem CID 22496570) has the molecular formula C13H18N4O
and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine.
Molecular Properties
| Compound Name | 1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine |
| PubChem CID | 22496570 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine |
| SMILES | CC(N)Cn1ncc2ccc3c(c21)CC(N)CO3 |
| InChI | InChI=1S/C13H18N4O/c1-8(14)6-17-13-9(5-16-17)2-3-12-11(13)4-10(15)7-18-12/h2-3,5,8,10H,4,6-7,14-15H2,1H3 |
| InChIKey | DEEMZCJFZLXGNK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine?
The IUPAC name of 1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine (CID 22496570) is 1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine.
What is the SMILES notation for 1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine?
The canonical SMILES for 1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine is CC(N)Cn1ncc2ccc3c(c21)CC(N)CO3.
What is the InChIKey of 1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine?
The InChIKey is DEEMZCJFZLXGNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O/c1-8(14)6-17-13-9(5-16-17)2-3-12-11(13)4-10(15)7-18-12/h2-3,5,8,10H,4,6-7,14-15H2,1H3.
What are the key properties of 1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine?
1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine has a molecular weight of 246.31 g/mol, XLogP of 0.65, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-amine is sourced from PubChem (CID 22496570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).