About 1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol
1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol (PubChem CID 22496571) has the molecular formula C13H15N5O2
and a molecular weight of 273.30 g/mol. Its IUPAC name is 1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol.
Molecular Properties
| Compound Name | 1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol |
| PubChem CID | 22496571 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol |
| SMILES | CC(Cn1ncc2ccc3c(c21)CC(O)CO3)N=[N+]=[N-] |
| InChI | InChI=1S/C13H15N5O2/c1-8(16-17-14)6-18-13-9(5-15-18)2-3-12-11(13)4-10(19)7-20-12/h2-3,5,8,10,19H,4,6-7H2,1H3 |
| InChIKey | ZPBYHDMYIBMTKN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol?
The IUPAC name of 1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol (CID 22496571) is 1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol.
What is the SMILES notation for 1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol?
The canonical SMILES for 1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol is CC(Cn1ncc2ccc3c(c21)CC(O)CO3)N=[N+]=[N-].
What is the InChIKey of 1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol?
The InChIKey is ZPBYHDMYIBMTKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5O2/c1-8(16-17-14)6-18-13-9(5-15-18)2-3-12-11(13)4-10(19)7-20-12/h2-3,5,8,10,19H,4,6-7H2,1H3.
What are the key properties of 1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol?
1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol has a molecular weight of 273.30 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-ol is sourced from PubChem (CID 22496571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).