C10H12O4 — CID 22496637
1,4-dimethylcyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 22496637) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 1,4-dimethylcyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 1,4-dimethylcyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 22496637 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1,4-dimethylcyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | CC1=CC(C(=O)O)C(C)(C(=O)O)C=C1 |
| InChI | InChI=1S/C10H12O4/c1-6-3-4-10(2,9(13)14)7(5-6)8(11)12/h3-5,7H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | IPIWYVWNQNHBFM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |