About propan-2-yl carbamodithioate
propan-2-yl carbamodithioate (PubChem CID 22496638) has the molecular formula C4H9NS2
and a molecular weight of 135.26 g/mol. Its IUPAC name is propan-2-yl carbamodithioate.
Molecular Properties
| Compound Name | propan-2-yl carbamodithioate |
| PubChem CID | 22496638 |
| Molecular Formula | C4H9NS2 |
| Molecular Weight | 135.26 g/mol |
| Exact Mass | 135.02 |
| IUPAC Name | propan-2-yl carbamodithioate |
| SMILES | CC(C)SC(N)=S |
| InChI | InChI=1S/C4H9NS2/c1-3(2)7-4(5)6/h3H,1-2H3,(H2,5,6) |
| InChIKey | VVFTZRWKAKOSBY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl carbamodithioate?
The IUPAC name of propan-2-yl carbamodithioate (CID 22496638) is propan-2-yl carbamodithioate.
What is the SMILES notation for propan-2-yl carbamodithioate?
The canonical SMILES for propan-2-yl carbamodithioate is CC(C)SC(N)=S.
What is the InChIKey of propan-2-yl carbamodithioate?
The InChIKey is VVFTZRWKAKOSBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NS2/c1-3(2)7-4(5)6/h3H,1-2H3,(H2,5,6).
What are the key properties of propan-2-yl carbamodithioate?
propan-2-yl carbamodithioate has a molecular weight of 135.26 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl carbamodithioate is sourced from PubChem (CID 22496638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).