About 3-methylbutan-2-olate
3-methylbutan-2-olate (PubChem CID 22496794) has the molecular formula C5H11O-
and a molecular weight of 87.14 g/mol. Its IUPAC name is 3-methylbutan-2-olate.
Molecular Properties
| Compound Name | 3-methylbutan-2-olate |
| PubChem CID | 22496794 |
| Molecular Formula | C5H11O- |
| Molecular Weight | 87.14 g/mol |
| Exact Mass | 87.08 |
| IUPAC Name | 3-methylbutan-2-olate |
| SMILES | CC(C)C(C)[O-] |
| InChI | InChI=1S/C5H11O/c1-4(2)5(3)6/h4-5H,1-3H3/q-1 |
| InChIKey | DNQDLYNHMRBFFJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.14 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylbutan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-olate?
The IUPAC name of 3-methylbutan-2-olate (CID 22496794) is 3-methylbutan-2-olate.
What is the SMILES notation for 3-methylbutan-2-olate?
The canonical SMILES for 3-methylbutan-2-olate is CC(C)C(C)[O-].
What is the InChIKey of 3-methylbutan-2-olate?
The InChIKey is DNQDLYNHMRBFFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11O/c1-4(2)5(3)6/h4-5H,1-3H3/q-1.
What are the key properties of 3-methylbutan-2-olate?
3-methylbutan-2-olate has a molecular weight of 87.14 g/mol, XLogP of 0.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-olate is sourced from PubChem (CID 22496794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).