About 1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese
1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese (PubChem CID 22496984) has the molecular formula C22H34Cl2MnN6
and a molecular weight of 508.40 g/mol. Its IUPAC name is 1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese.
Molecular Properties
| Compound Name | 1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese |
| PubChem CID | 22496984 |
| Molecular Formula | C22H34Cl2MnN6 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese |
| SMILES | CCCCc1ccn(C(n2ccc(CCCC)n2)n2ccc(CCCC)n2)n1.Cl[Mn]Cl |
| InChI | InChI=1S/C22H34N6.2ClH.Mn/c1-4-7-10-19-13-16-26(23-19)22(27-17-14-20(24-27)11-8-5-2)28-18-15-21(25-28)12-9-6-3;;;/h13-18,22H,4-12H2,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | QRMQYXJCOFRVEW-UHFFFAOYSA-L |
| XLogP | 6.23 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese?
The IUPAC name of 1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese (CID 22496984) is 1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese.
What is the SMILES notation for 1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese?
The canonical SMILES for 1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese is CCCCc1ccn(C(n2ccc(CCCC)n2)n2ccc(CCCC)n2)n1.Cl[Mn]Cl.
What is the InChIKey of 1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese?
The InChIKey is QRMQYXJCOFRVEW-UHFFFAOYSA-L. The full InChI is InChI=1S/C22H34N6.2ClH.Mn/c1-4-7-10-19-13-16-26(23-19)22(27-17-14-20(24-27)11-8-5-2)28-18-15-21(25-28)12-9-6-3;;;/h13-18,22H,4-12H2,1-3H3;2*1H;/q;;;+2/p-2.
What are the key properties of 1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese?
1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese has a molecular weight of 508.40 g/mol, XLogP of 6.23, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(3-butylpyrazol-1-yl)methyl]-3-butylpyrazole;dichloromanganese is sourced from PubChem (CID 22496984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).