About 3,5-dibutyl-3H-pyrazole
3,5-dibutyl-3H-pyrazole (PubChem CID 22497050) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 3,5-dibutyl-3H-pyrazole.
Molecular Properties
| Compound Name | 3,5-dibutyl-3H-pyrazole |
| PubChem CID | 22497050 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 3,5-dibutyl-3H-pyrazole |
| SMILES | CCCCC1=CC(CCCC)N=N1 |
| InChI | InChI=1S/C11H20N2/c1-3-5-7-10-9-11(13-12-10)8-6-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | VKJJSGJVDLQRRA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dibutyl-3H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibutyl-3H-pyrazole?
The IUPAC name of 3,5-dibutyl-3H-pyrazole (CID 22497050) is 3,5-dibutyl-3H-pyrazole.
What is the SMILES notation for 3,5-dibutyl-3H-pyrazole?
The canonical SMILES for 3,5-dibutyl-3H-pyrazole is CCCCC1=CC(CCCC)N=N1.
What is the InChIKey of 3,5-dibutyl-3H-pyrazole?
The InChIKey is VKJJSGJVDLQRRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-3-5-7-10-9-11(13-12-10)8-6-4-2/h9-10H,3-8H2,1-2H3.
What are the key properties of 3,5-dibutyl-3H-pyrazole?
3,5-dibutyl-3H-pyrazole has a molecular weight of 180.29 g/mol, XLogP of 4.09, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibutyl-3H-pyrazole is sourced from PubChem (CID 22497050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).