C12H24B2O6 — CID 22497760
4-methyl-2-[4-(4-methyl-1,3,2-dioxaborinan-2-yl)butan-2-ylperoxy]-1,3,2-dioxaborinane (PubChem CID 22497760) has the molecular formula C12H24B2O6 and a molecular weight of 285.94 g/mol. Its IUPAC name is 4-methyl-2-[4-(4-methyl-1,3,2-dioxaborinan-2-yl)butan-2-ylperoxy]-1,3,2-dioxaborinane.
| Compound Name | 4-methyl-2-[4-(4-methyl-1,3,2-dioxaborinan-2-yl)butan-2-ylperoxy]-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 22497760 |
| Molecular Formula | C12H24B2O6 |
| Molecular Weight | 285.94 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 4-methyl-2-[4-(4-methyl-1,3,2-dioxaborinan-2-yl)butan-2-ylperoxy]-1,3,2-dioxaborinane |
| SMILES | CC(CCB1OCCC(C)O1)OOB1OCCC(C)O1 |
| InChI | InChI=1S/C12H24B2O6/c1-10-5-8-15-13(17-10)7-4-12(3)19-20-14-16-9-6-11(2)18-14/h10-12H,4-9H2,1-3H3 |
| InChIKey | DBZSDUAIKAHHLZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.94 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|