C12H17F3N2O6 — CID 22497884
1-hydroxypyrrolidine-2,5-dione;2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (PubChem CID 22497884) has the molecular formula C12H17F3N2O6 and a molecular weight of 342.27 g/mol. Its IUPAC name is 1-hydroxypyrrolidine-2,5-dione;2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid.
| Compound Name | 1-hydroxypyrrolidine-2,5-dione;2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 22497884 |
| Molecular Formula | C12H17F3N2O6 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-hydroxypyrrolidine-2,5-dione;2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)C(F)(F)F)C(=O)O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C8H12F3NO3.C4H5NO3/c1-2-3-4-5(6(13)14)12-7(15)8(9,10)11;6-3-1-2-4(7)5(3)8/h5H,2-4H2,1H3,(H,12,15)(H,13,14);8H,1-2H2 |
| InChIKey | ARQHUDWGBGMUPH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|