About 6-methylnaphthalene-1,2,3-triol
6-methylnaphthalene-1,2,3-triol (PubChem CID 22497955) has the molecular formula C11H10O3
and a molecular weight of 190.20 g/mol. Its IUPAC name is 6-methylnaphthalene-1,2,3-triol.
Molecular Properties
| Compound Name | 6-methylnaphthalene-1,2,3-triol |
| PubChem CID | 22497955 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 6-methylnaphthalene-1,2,3-triol |
| SMILES | Cc1ccc2c(O)c(O)c(O)cc2c1 |
| InChI | InChI=1S/C11H10O3/c1-6-2-3-8-7(4-6)5-9(12)11(14)10(8)13/h2-5,12-14H,1H3 |
| InChIKey | QKUQTNHVGJODAR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 6-methylnaphthalene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylnaphthalene-1,2,3-triol?
The IUPAC name of 6-methylnaphthalene-1,2,3-triol (CID 22497955) is 6-methylnaphthalene-1,2,3-triol.
What is the SMILES notation for 6-methylnaphthalene-1,2,3-triol?
The canonical SMILES for 6-methylnaphthalene-1,2,3-triol is Cc1ccc2c(O)c(O)c(O)cc2c1.
What is the InChIKey of 6-methylnaphthalene-1,2,3-triol?
The InChIKey is QKUQTNHVGJODAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3/c1-6-2-3-8-7(4-6)5-9(12)11(14)10(8)13/h2-5,12-14H,1H3.
What are the key properties of 6-methylnaphthalene-1,2,3-triol?
6-methylnaphthalene-1,2,3-triol has a molecular weight of 190.20 g/mol, XLogP of 2.27, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylnaphthalene-1,2,3-triol is sourced from PubChem (CID 22497955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).