About 5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole
5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole (PubChem CID 22498835) has the molecular formula C15H15NS2
and a molecular weight of 273.43 g/mol. Its IUPAC name is 5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole |
| PubChem CID | 22498835 |
| Molecular Formula | C15H15NS2 |
| Molecular Weight | 273.43 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole |
| SMILES | CSc1ccc(Sc2ccc3c(c2)CCN3)cc1 |
| InChI | InChI=1S/C15H15NS2/c1-17-12-2-4-13(5-3-12)18-14-6-7-15-11(10-14)8-9-16-15/h2-7,10,16H,8-9H2,1H3 |
| InChIKey | JLEBKRCIQVWCJD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole?
The IUPAC name of 5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole (CID 22498835) is 5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole?
The canonical SMILES for 5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole is CSc1ccc(Sc2ccc3c(c2)CCN3)cc1.
What is the InChIKey of 5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole?
The InChIKey is JLEBKRCIQVWCJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NS2/c1-17-12-2-4-13(5-3-12)18-14-6-7-15-11(10-14)8-9-16-15/h2-7,10,16H,8-9H2,1H3.
What are the key properties of 5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole?
5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole has a molecular weight of 273.43 g/mol, XLogP of 4.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylsulfanylphenyl)sulfanyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 22498835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).