C14H20N4O5 — CID 22499053
6-(3-methyl-2,6,8-trioxo-7,9-dihydropurin-1-yl)hexan-2-yl acetate (PubChem CID 22499053) has the molecular formula C14H20N4O5 and a molecular weight of 324.34 g/mol. Its IUPAC name is 6-(3-methyl-2,6,8-trioxo-7,9-dihydropurin-1-yl)hexan-2-yl acetate.
| Compound Name | 6-(3-methyl-2,6,8-trioxo-7,9-dihydropurin-1-yl)hexan-2-yl acetate |
|---|---|
| PubChem CID | 22499053 |
| Molecular Formula | C14H20N4O5 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 6-(3-methyl-2,6,8-trioxo-7,9-dihydropurin-1-yl)hexan-2-yl acetate |
| SMILES | CC(=O)OC(C)CCCCn1c(=O)c2[nH]c(=O)[nH]c2n(C)c1=O |
| InChI | InChI=1S/C14H20N4O5/c1-8(23-9(2)19)6-4-5-7-18-12(20)10-11(16-13(21)15-10)17(3)14(18)22/h8H,4-7H2,1-3H3,(H2,15,16,21) |
| InChIKey | KFIFQQINZSZWMW-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|