About 5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine
5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine (PubChem CID 22499232) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine.
Molecular Properties
| Compound Name | 5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine |
| PubChem CID | 22499232 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine |
| SMILES | CCc1cc2c(cc1CC)CC(C)(N)C2 |
| InChI | InChI=1S/C14H21N/c1-4-10-6-12-8-14(3,15)9-13(12)7-11(10)5-2/h6-7H,4-5,8-9,15H2,1-3H3 |
| InChIKey | UQGBLGLYOTZUIW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine?
The IUPAC name of 5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine (CID 22499232) is 5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine.
What is the SMILES notation for 5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine?
The canonical SMILES for 5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine is CCc1cc2c(cc1CC)CC(C)(N)C2.
What is the InChIKey of 5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine?
The InChIKey is UQGBLGLYOTZUIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-4-10-6-12-8-14(3,15)9-13(12)7-11(10)5-2/h6-7H,4-5,8-9,15H2,1-3H3.
What are the key properties of 5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine?
5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine has a molecular weight of 203.33 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diethyl-2-methyl-1,3-dihydroinden-2-amine is sourced from PubChem (CID 22499232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).