4-propan-2-yl-1,3-thiazole-2-carboxylic acid

C7H9NO2S — CID 22499307

IUPAC4-propan-2-yl-1,3-thiazole-2-carboxylic acid
SMILESCC(C)c1csc(C(=O)O)n1
InChIInChI=1S/C7H9NO2S/c1-4(2)5-3-11-6(8-5)7(9)10/h3-4H,1-2H3,(H,9,10)
InChIKeyRDWHKWXYJQUZNS-UHFFFAOYSA-N
MW171.22 g/mol
LogP1.96
Rot. Bonds2

About 4-propan-2-yl-1,3-thiazole-2-carboxylic acid

4-propan-2-yl-1,3-thiazole-2-carboxylic acid (PubChem CID 22499307) has the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. Its IUPAC name is 4-propan-2-yl-1,3-thiazole-2-carboxylic acid.

Molecular Properties

Compound Name4-propan-2-yl-1,3-thiazole-2-carboxylic acid
PubChem CID22499307
Molecular FormulaC7H9NO2S
Molecular Weight171.22 g/mol
Exact Mass171.04
IUPAC Name4-propan-2-yl-1,3-thiazole-2-carboxylic acid
SMILESCC(C)c1csc(C(=O)O)n1
InChIInChI=1S/C7H9NO2S/c1-4(2)5-3-11-6(8-5)7(9)10/h3-4H,1-2H3,(H,9,10)
InChIKeyRDWHKWXYJQUZNS-UHFFFAOYSA-N
XLogP1.96
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.22
LogP ≤ 51.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-propan-2-yl-1,3-thiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-propan-2-yl-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 4-propan-2-yl-1,3-thiazole-2-carboxylic acid (CID 22499307) is 4-propan-2-yl-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 4-propan-2-yl-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 4-propan-2-yl-1,3-thiazole-2-carboxylic acid is CC(C)c1csc(C(=O)O)n1.
What is the InChIKey of 4-propan-2-yl-1,3-thiazole-2-carboxylic acid?
The InChIKey is RDWHKWXYJQUZNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2S/c1-4(2)5-3-11-6(8-5)7(9)10/h3-4H,1-2H3,(H,9,10).
What are the key properties of 4-propan-2-yl-1,3-thiazole-2-carboxylic acid?
4-propan-2-yl-1,3-thiazole-2-carboxylic acid has a molecular weight of 171.22 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 22499307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).