C18H28O4Si — CID 22499793
6-(2-cyclopentyl-2-hydroxy-4-trimethylsilylbut-3-ynyl)-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 22499793) has the molecular formula C18H28O4Si and a molecular weight of 336.50 g/mol. Its IUPAC name is 6-(2-cyclopentyl-2-hydroxy-4-trimethylsilylbut-3-ynyl)-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-(2-cyclopentyl-2-hydroxy-4-trimethylsilylbut-3-ynyl)-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 22499793 |
| Molecular Formula | C18H28O4Si |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 6-(2-cyclopentyl-2-hydroxy-4-trimethylsilylbut-3-ynyl)-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC1(C)OC(=O)C=C(CC(O)(C#C[Si](C)(C)C)C2CCCC2)O1 |
| InChI | InChI=1S/C18H28O4Si/c1-17(2)21-15(12-16(19)22-17)13-18(20,10-11-23(3,4)5)14-8-6-7-9-14/h12,14,20H,6-9,13H2,1-5H3 |
| InChIKey | IEQVMIBQUXHVPX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|