About 2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride
2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride (PubChem CID 22500053) has the molecular formula C7H3ClF2O4S
and a molecular weight of 256.61 g/mol. Its IUPAC name is 2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride |
| PubChem CID | 22500053 |
| Molecular Formula | C7H3ClF2O4S |
| Molecular Weight | 256.61 g/mol |
| Exact Mass | 255.94 |
| IUPAC Name | 2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C7H3ClF2O4S/c8-15(11,12)4-1-2-5-6(3-4)14-7(9,10)13-5/h1-3H |
| InChIKey | SRKKEBOPDXVTLV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.61 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride?
The IUPAC name of 2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride (CID 22500053) is 2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride.
What is the SMILES notation for 2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride?
The canonical SMILES for 2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride is O=S(=O)(Cl)c1ccc2c(c1)OC(F)(F)O2.
What is the InChIKey of 2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride?
The InChIKey is SRKKEBOPDXVTLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClF2O4S/c8-15(11,12)4-1-2-5-6(3-4)14-7(9,10)13-5/h1-3H.
What are the key properties of 2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride?
2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride has a molecular weight of 256.61 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-1,3-benzodioxole-5-sulfonyl chloride is sourced from PubChem (CID 22500053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).