About ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate
ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate (PubChem CID 22500685) has the molecular formula C25H26ClNO3
and a molecular weight of 423.94 g/mol. Its IUPAC name is ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate |
| PubChem CID | 22500685 |
| Molecular Formula | C25H26ClNO3 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(-c2ccc(Cl)cc2)c(-c2ccc(O)cc2)c2n1CC(C)(C)C2 |
| InChI | InChI=1S/C25H26ClNO3/c1-4-30-22(29)13-20-23(16-5-9-18(26)10-6-16)24(17-7-11-19(28)12-8-17)21-14-25(2,3)15-27(20)21/h5-12,28H,4,13-15H2,1-3H3 |
| InChIKey | HAFYMPDNPZDCSF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate?
The IUPAC name of ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate (CID 22500685) is ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate.
What is the SMILES notation for ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate?
The canonical SMILES for ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate is CCOC(=O)Cc1c(-c2ccc(Cl)cc2)c(-c2ccc(O)cc2)c2n1CC(C)(C)C2.
What is the InChIKey of ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate?
The InChIKey is HAFYMPDNPZDCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26ClNO3/c1-4-30-22(29)13-20-23(16-5-9-18(26)10-6-16)24(17-7-11-19(28)12-8-17)21-14-25(2,3)15-27(20)21/h5-12,28H,4,13-15H2,1-3H3.
What are the key properties of ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate?
ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate has a molecular weight of 423.94 g/mol, XLogP of 5.87, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(4-chlorophenyl)-1-(4-hydroxyphenyl)-6,6-dimethyl-5,7-dihydropyrrolizin-3-yl]acetate is sourced from PubChem (CID 22500685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).