C33H9BF18 — CID 22501011
tris(2,3,4,5,7,8-hexafluoro-6-methylnaphthalen-1-yl)borane (PubChem CID 22501011) has the molecular formula C33H9BF18 and a molecular weight of 758.21 g/mol. Its IUPAC name is tris(2,3,4,5,7,8-hexafluoro-6-methylnaphthalen-1-yl)borane.
| Compound Name | tris(2,3,4,5,7,8-hexafluoro-6-methylnaphthalen-1-yl)borane |
|---|---|
| PubChem CID | 22501011 |
| Molecular Formula | C33H9BF18 |
| Molecular Weight | 758.21 g/mol |
| Exact Mass | 758.05 |
| IUPAC Name | tris(2,3,4,5,7,8-hexafluoro-6-methylnaphthalen-1-yl)borane |
| SMILES | Cc1c(F)c(F)c2c(B(c3c(F)c(F)c(F)c4c(F)c(C)c(F)c(F)c34)c3c(F)c(F)c(F)c4c(F)c(C)c(F)c(F)c34)c(F)c(F)c(F)c2c1F |
| InChI | InChI=1S/C33H9BF18/c1-4-16(35)10-7(22(41)19(4)38)13(28(47)31(50)25(10)44)34(14-8-11(26(45)32(51)29(14)48)17(36)5(2)20(39)23(8)42)15-9-12(27(46)33(52)30(15)49)18(37)6(3)21(40)24(9)43/h1-3H3 |
| InChIKey | KYZODXBGFMMRHJ-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.21 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|