C20H32F9N — CID 22501127
N-[1,6-difluoro-2,3,3,4,4,5,5-heptakis(fluoromethyl)hexan-2-yl]-4-methylcyclohexan-1-amine (PubChem CID 22501127) has the molecular formula C20H32F9N and a molecular weight of 457.47 g/mol. Its IUPAC name is N-[1,6-difluoro-2,3,3,4,4,5,5-heptakis(fluoromethyl)hexan-2-yl]-4-methylcyclohexan-1-amine.
| Compound Name | N-[1,6-difluoro-2,3,3,4,4,5,5-heptakis(fluoromethyl)hexan-2-yl]-4-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 22501127 |
| Molecular Formula | C20H32F9N |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | N-[1,6-difluoro-2,3,3,4,4,5,5-heptakis(fluoromethyl)hexan-2-yl]-4-methylcyclohexan-1-amine |
| SMILES | CC1CCC(NC(CF)(CF)C(CF)(CF)C(CF)(CF)C(CF)(CF)CF)CC1 |
| InChI | InChI=1S/C20H32F9N/c1-15-2-4-16(5-3-15)30-20(13-28,14-29)19(11-26,12-27)18(9-24,10-25)17(6-21,7-22)8-23/h15-16,30H,2-14H2,1H3 |
| InChIKey | KHCBZUFCDNOFQM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |