About [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol
[4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol (PubChem CID 22502656) has the molecular formula C28H27N5OS2
and a molecular weight of 513.69 g/mol. Its IUPAC name is [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol.
Molecular Properties
| Compound Name | [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol |
| PubChem CID | 22502656 |
| Molecular Formula | C28H27N5OS2 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol |
| SMILES | CCN1CCN(c2nc(-c3ccc(C(O)(c4nccs4)c4nccs4)cc3)cc3ccccc23)CC1 |
| InChI | InChI=1S/C28H27N5OS2/c1-2-32-13-15-33(16-14-32)25-23-6-4-3-5-21(23)19-24(31-25)20-7-9-22(10-8-20)28(34,26-29-11-17-35-26)27-30-12-18-36-27/h3-12,17-19,34H,2,13-16H2,1H3 |
| InChIKey | LRAXMPDFLSGNKX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol?
The IUPAC name of [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol (CID 22502656) is [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol.
What is the SMILES notation for [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol?
The canonical SMILES for [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol is CCN1CCN(c2nc(-c3ccc(C(O)(c4nccs4)c4nccs4)cc3)cc3ccccc23)CC1.
What is the InChIKey of [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol?
The InChIKey is LRAXMPDFLSGNKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27N5OS2/c1-2-32-13-15-33(16-14-32)25-23-6-4-3-5-21(23)19-24(31-25)20-7-9-22(10-8-20)28(34,26-29-11-17-35-26)27-30-12-18-36-27/h3-12,17-19,34H,2,13-16H2,1H3.
What are the key properties of [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol?
[4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol has a molecular weight of 513.69 g/mol, XLogP of 5.24, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1-(4-ethylpiperazin-1-yl)isoquinolin-3-yl]phenyl]-bis(1,3-thiazol-2-yl)methanol is sourced from PubChem (CID 22502656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).