About 4-(2-bromophenyl)-3,6-dihydro-2H-pyran
4-(2-bromophenyl)-3,6-dihydro-2H-pyran (PubChem CID 22503115) has the molecular formula C11H11BrO
and a molecular weight of 239.11 g/mol. Its IUPAC name is 4-(2-bromophenyl)-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 4-(2-bromophenyl)-3,6-dihydro-2H-pyran |
| PubChem CID | 22503115 |
| Molecular Formula | C11H11BrO |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 4-(2-bromophenyl)-3,6-dihydro-2H-pyran |
| SMILES | Brc1ccccc1C1=CCOCC1 |
| InChI | InChI=1S/C11H11BrO/c12-11-4-2-1-3-10(11)9-5-7-13-8-6-9/h1-5H,6-8H2 |
| InChIKey | ZDELMLVIDSHCHD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2-bromophenyl)-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromophenyl)-3,6-dihydro-2H-pyran?
The IUPAC name of 4-(2-bromophenyl)-3,6-dihydro-2H-pyran (CID 22503115) is 4-(2-bromophenyl)-3,6-dihydro-2H-pyran.
What is the SMILES notation for 4-(2-bromophenyl)-3,6-dihydro-2H-pyran?
The canonical SMILES for 4-(2-bromophenyl)-3,6-dihydro-2H-pyran is Brc1ccccc1C1=CCOCC1.
What is the InChIKey of 4-(2-bromophenyl)-3,6-dihydro-2H-pyran?
The InChIKey is ZDELMLVIDSHCHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO/c12-11-4-2-1-3-10(11)9-5-7-13-8-6-9/h1-5H,6-8H2.
What are the key properties of 4-(2-bromophenyl)-3,6-dihydro-2H-pyran?
4-(2-bromophenyl)-3,6-dihydro-2H-pyran has a molecular weight of 239.11 g/mol, XLogP of 3.25, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromophenyl)-3,6-dihydro-2H-pyran is sourced from PubChem (CID 22503115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).