C14H11NO7S — CID 22503939
4-amino-1,3-dihydroxy-9,10-dioxo-8a,10a-dihydroanthracene-2-sulfonic acid (PubChem CID 22503939) has the molecular formula C14H11NO7S and a molecular weight of 337.31 g/mol. Its IUPAC name is 4-amino-1,3-dihydroxy-9,10-dioxo-8a,10a-dihydroanthracene-2-sulfonic acid.
| Compound Name | 4-amino-1,3-dihydroxy-9,10-dioxo-8a,10a-dihydroanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 22503939 |
| Molecular Formula | C14H11NO7S |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 4-amino-1,3-dihydroxy-9,10-dioxo-8a,10a-dihydroanthracene-2-sulfonic acid |
| SMILES | Nc1c(O)c(S(=O)(=O)O)c(O)c2c1C(=O)C1C=CC=CC1C2=O |
| InChI | InChI=1S/C14H11NO7S/c15-9-7-8(12(18)14(13(9)19)23(20,21)22)11(17)6-4-2-1-3-5(6)10(7)16/h1-6,18-19H,15H2,(H,20,21,22) |
| InChIKey | GDKKAFUWJRNTRZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|