About 2-quinolin-5-ylethanol
2-quinolin-5-ylethanol (PubChem CID 22504132) has the molecular formula C11H11NO
and a molecular weight of 173.22 g/mol. Its IUPAC name is 2-quinolin-5-ylethanol.
Molecular Properties
| Compound Name | 2-quinolin-5-ylethanol |
| PubChem CID | 22504132 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 2-quinolin-5-ylethanol |
| SMILES | OCCc1cccc2ncccc12 |
| InChI | InChI=1S/C11H11NO/c13-8-6-9-3-1-5-11-10(9)4-2-7-12-11/h1-5,7,13H,6,8H2 |
| InChIKey | CJFSLXUSMNTOJH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-quinolin-5-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-quinolin-5-ylethanol?
The IUPAC name of 2-quinolin-5-ylethanol (CID 22504132) is 2-quinolin-5-ylethanol.
What is the SMILES notation for 2-quinolin-5-ylethanol?
The canonical SMILES for 2-quinolin-5-ylethanol is OCCc1cccc2ncccc12.
What is the InChIKey of 2-quinolin-5-ylethanol?
The InChIKey is CJFSLXUSMNTOJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c13-8-6-9-3-1-5-11-10(9)4-2-7-12-11/h1-5,7,13H,6,8H2.
What are the key properties of 2-quinolin-5-ylethanol?
2-quinolin-5-ylethanol has a molecular weight of 173.22 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-quinolin-5-ylethanol is sourced from PubChem (CID 22504132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).