About 1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol
1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol (PubChem CID 22504210) has the molecular formula C9H10ClN3O
and a molecular weight of 211.65 g/mol. Its IUPAC name is 1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol |
| PubChem CID | 22504210 |
| Molecular Formula | C9H10ClN3O |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol |
| SMILES | CC(O)Cn1cnc2ccc(Cl)nc21 |
| InChI | InChI=1S/C9H10ClN3O/c1-6(14)4-13-5-11-7-2-3-8(10)12-9(7)13/h2-3,5-6,14H,4H2,1H3 |
| InChIKey | CKEASLIJRNXCGZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol?
The IUPAC name of 1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol (CID 22504210) is 1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol.
What is the SMILES notation for 1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol?
The canonical SMILES for 1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol is CC(O)Cn1cnc2ccc(Cl)nc21.
What is the InChIKey of 1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol?
The InChIKey is CKEASLIJRNXCGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN3O/c1-6(14)4-13-5-11-7-2-3-8(10)12-9(7)13/h2-3,5-6,14H,4H2,1H3.
What are the key properties of 1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol?
1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol has a molecular weight of 211.65 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloroimidazo[4,5-b]pyridin-3-yl)propan-2-ol is sourced from PubChem (CID 22504210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).