About 2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid
2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid (PubChem CID 22504783) has the molecular formula C18H16F4O3S
and a molecular weight of 388.38 g/mol. Its IUPAC name is 2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid |
| PubChem CID | 22504783 |
| Molecular Formula | C18H16F4O3S |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid |
| SMILES | Cc1cc(SCc2ccc(C(F)(F)F)cc2F)cc(C)c1OCC(=O)O |
| InChI | InChI=1S/C18H16F4O3S/c1-10-5-14(6-11(2)17(10)25-8-16(23)24)26-9-12-3-4-13(7-15(12)19)18(20,21)22/h3-7H,8-9H2,1-2H3,(H,23,24) |
| InChIKey | TXKXUNZFEDHSSC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid?
The IUPAC name of 2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid (CID 22504783) is 2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid.
What is the SMILES notation for 2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid?
The canonical SMILES for 2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid is Cc1cc(SCc2ccc(C(F)(F)F)cc2F)cc(C)c1OCC(=O)O.
What is the InChIKey of 2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid?
The InChIKey is TXKXUNZFEDHSSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F4O3S/c1-10-5-14(6-11(2)17(10)25-8-16(23)24)26-9-12-3-4-13(7-15(12)19)18(20,21)22/h3-7H,8-9H2,1-2H3,(H,23,24).
What are the key properties of 2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid?
2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid has a molecular weight of 388.38 g/mol, XLogP of 5.22, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]-2,6-dimethylphenoxy]acetic acid is sourced from PubChem (CID 22504783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).