C20H22F3NO3S — CID 22504950
2-[4-[2-[N-ethyl-3-(trifluoromethyl)anilino]ethylsulfanyl]-2-methylphenoxy]acetic acid (PubChem CID 22504950) has the molecular formula C20H22F3NO3S and a molecular weight of 413.46 g/mol. Its IUPAC name is 2-[4-[2-[N-ethyl-3-(trifluoromethyl)anilino]ethylsulfanyl]-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[2-[N-ethyl-3-(trifluoromethyl)anilino]ethylsulfanyl]-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 22504950 |
| Molecular Formula | C20H22F3NO3S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-[4-[2-[N-ethyl-3-(trifluoromethyl)anilino]ethylsulfanyl]-2-methylphenoxy]acetic acid |
| SMILES | CCN(CCSc1ccc(OCC(=O)O)c(C)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H22F3NO3S/c1-3-24(16-6-4-5-15(12-16)20(21,22)23)9-10-28-17-7-8-18(14(2)11-17)27-13-19(25)26/h4-8,11-12H,3,9-10,13H2,1-2H3,(H,25,26) |
| InChIKey | YJGZSRGWHMNKQX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |